C16H12N2O6S — CID 10737216
3-(2,5-dioxo-3-phenylimidazolidin-1-yl)sulfonylbenzoic acid (PubChem CID 10737216) has the molecular formula C16H12N2O6S and a molecular weight of 360.35 g/mol. Its IUPAC name is 3-(2,5-dioxo-3-phenylimidazolidin-1-yl)sulfonylbenzoic acid.
| Compound Name | 3-(2,5-dioxo-3-phenylimidazolidin-1-yl)sulfonylbenzoic acid |
|---|---|
| PubChem CID | 10737216 |
| Molecular Formula | C16H12N2O6S |
| Molecular Weight | 360.35 g/mol |
| Exact Mass | 360.04 |
| IUPAC Name | 3-(2,5-dioxo-3-phenylimidazolidin-1-yl)sulfonylbenzoic acid |
| SMILES | O=C(O)c1cccc(S(=O)(=O)N2C(=O)CN(c3ccccc3)C2=O)c1 |
| InChI | InChI=1S/C16H12N2O6S/c19-14-10-17(12-6-2-1-3-7-12)16(22)18(14)25(23,24)13-8-4-5-11(9-13)15(20)21/h1-9H,10H2,(H,20,21) |
| InChIKey | AEVPIESDIOSSSM-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 112.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.35 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|