C17H14N2O6S — CID 139711429
3-[(4S)-4-benzyl-2,5-dioxoimidazolidin-1-yl]sulfonylbenzoic acid (PubChem CID 139711429) has the molecular formula C17H14N2O6S and a molecular weight of 374.37 g/mol. Its IUPAC name is 3-[(4S)-4-benzyl-2,5-dioxoimidazolidin-1-yl]sulfonylbenzoic acid.
| Compound Name | 3-[(4S)-4-benzyl-2,5-dioxoimidazolidin-1-yl]sulfonylbenzoic acid |
|---|---|
| PubChem CID | 139711429 |
| Molecular Formula | C17H14N2O6S |
| Molecular Weight | 374.37 g/mol |
| Exact Mass | 374.06 |
| IUPAC Name | 3-[(4S)-4-benzyl-2,5-dioxoimidazolidin-1-yl]sulfonylbenzoic acid |
| SMILES | O=C(O)c1cccc(S(=O)(=O)N2C(=O)N[C@@H](Cc3ccccc3)C2=O)c1 |
| InChI | InChI=1S/C17H14N2O6S/c20-15-14(9-11-5-2-1-3-6-11)18-17(23)19(15)26(24,25)13-8-4-7-12(10-13)16(21)22/h1-8,10,14H,9H2,(H,18,23)(H,21,22)/t14-/m0/s1 |
| InChIKey | YBWIXHRFOZNNHM-AWEZNQCLSA-N |
| XLogP | 1.24 |
| TPSA | 120.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.37 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|