C18H18N2O4S — CID 139711441
(5S)-5-benzyl-3-(3,4-dimethylphenyl)sulfonylimidazolidine-2,4-dione (PubChem CID 139711441) has the molecular formula C18H18N2O4S and a molecular weight of 358.42 g/mol. Its IUPAC name is (5S)-5-benzyl-3-(3,4-dimethylphenyl)sulfonylimidazolidine-2,4-dione.
| Compound Name | (5S)-5-benzyl-3-(3,4-dimethylphenyl)sulfonylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 139711441 |
| Molecular Formula | C18H18N2O4S |
| Molecular Weight | 358.42 g/mol |
| Exact Mass | 358.10 |
| IUPAC Name | (5S)-5-benzyl-3-(3,4-dimethylphenyl)sulfonylimidazolidine-2,4-dione |
| SMILES | Cc1ccc(S(=O)(=O)N2C(=O)N[C@@H](Cc3ccccc3)C2=O)cc1C |
| InChI | InChI=1S/C18H18N2O4S/c1-12-8-9-15(10-13(12)2)25(23,24)20-17(21)16(19-18(20)22)11-14-6-4-3-5-7-14/h3-10,16H,11H2,1-2H3,(H,19,22)/t16-/m0/s1 |
| InChIKey | FVABSWZHYQHQRJ-INIZCTEOSA-N |
| XLogP | 2.16 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.42 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|