C17H15ClN2O4S — CID 139711446
(5S)-3-(4-chlorophenyl)sulfonyl-5-(2-phenylethyl)imidazolidine-2,4-dione (PubChem CID 139711446) has the molecular formula C17H15ClN2O4S and a molecular weight of 378.84 g/mol. Its IUPAC name is (5S)-3-(4-chlorophenyl)sulfonyl-5-(2-phenylethyl)imidazolidine-2,4-dione.
| Compound Name | (5S)-3-(4-chlorophenyl)sulfonyl-5-(2-phenylethyl)imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 139711446 |
| Molecular Formula | C17H15ClN2O4S |
| Molecular Weight | 378.84 g/mol |
| Exact Mass | 378.04 |
| IUPAC Name | (5S)-3-(4-chlorophenyl)sulfonyl-5-(2-phenylethyl)imidazolidine-2,4-dione |
| SMILES | O=C1N[C@@H](CCc2ccccc2)C(=O)N1S(=O)(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C17H15ClN2O4S/c18-13-7-9-14(10-8-13)25(23,24)20-16(21)15(19-17(20)22)11-6-12-4-2-1-3-5-12/h1-5,7-10,15H,6,11H2,(H,19,22)/t15-/m0/s1 |
| InChIKey | XMROBBJUASDIQO-HNNXBMFYSA-N |
| XLogP | 2.58 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.84 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|