C24H23N3O4S — CID 56856235
(7S,9aR)-7-benzyl-2-naphthalen-2-ylsulfonyl-1,3,4,7,8,9a-hexahydropyrazino[1,2-a]pyrazine-6,9-dione (PubChem CID 56856235) has the molecular formula C24H23N3O4S and a molecular weight of 449.53 g/mol. Its IUPAC name is (7S,9aR)-7-benzyl-2-naphthalen-2-ylsulfonyl-1,3,4,7,8,9a-hexahydropyrazino[1,2-a]pyrazine-6,9-dione.
| Compound Name | (7S,9aR)-7-benzyl-2-naphthalen-2-ylsulfonyl-1,3,4,7,8,9a-hexahydropyrazino[1,2-a]pyrazine-6,9-dione |
|---|---|
| PubChem CID | 56856235 |
| Molecular Formula | C24H23N3O4S |
| Molecular Weight | 449.53 g/mol |
| Exact Mass | 449.14 |
| IUPAC Name | (7S,9aR)-7-benzyl-2-naphthalen-2-ylsulfonyl-1,3,4,7,8,9a-hexahydropyrazino[1,2-a]pyrazine-6,9-dione |
| SMILES | O=C1N[C@@H](Cc2ccccc2)C(=O)N2CCN(S(=O)(=O)c3ccc4ccccc4c3)C[C@H]12 |
| InChI | InChI=1S/C24H23N3O4S/c28-23-22-16-26(32(30,31)20-11-10-18-8-4-5-9-19(18)15-20)12-13-27(22)24(29)21(25-23)14-17-6-2-1-3-7-17/h1-11,15,21-22H,12-14,16H2,(H,25,28)/t21-,22+/m0/s1 |
| InChIKey | LWMSALJTBZEPMU-FCHUYYIVSA-N |
| XLogP | 1.78 |
| TPSA | 86.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.53 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |