C16H21N3O5S — CID 56852605
(7R,9aR)-2-(2,5-dimethylphenyl)sulfonyl-7-(hydroxymethyl)-1,3,4,7,8,9a-hexahydropyrazino[1,2-a]pyrazine-6,9-dione (PubChem CID 56852605) has the molecular formula C16H21N3O5S and a molecular weight of 367.43 g/mol. Its IUPAC name is (7R,9aR)-2-(2,5-dimethylphenyl)sulfonyl-7-(hydroxymethyl)-1,3,4,7,8,9a-hexahydropyrazino[1,2-a]pyrazine-6,9-dione.
| Compound Name | (7R,9aR)-2-(2,5-dimethylphenyl)sulfonyl-7-(hydroxymethyl)-1,3,4,7,8,9a-hexahydropyrazino[1,2-a]pyrazine-6,9-dione |
|---|---|
| PubChem CID | 56852605 |
| Molecular Formula | C16H21N3O5S |
| Molecular Weight | 367.43 g/mol |
| Exact Mass | 367.12 |
| IUPAC Name | (7R,9aR)-2-(2,5-dimethylphenyl)sulfonyl-7-(hydroxymethyl)-1,3,4,7,8,9a-hexahydropyrazino[1,2-a]pyrazine-6,9-dione |
| SMILES | Cc1ccc(C)c(S(=O)(=O)N2CCN3C(=O)[C@@H](CO)NC(=O)[C@H]3C2)c1 |
| InChI | InChI=1S/C16H21N3O5S/c1-10-3-4-11(2)14(7-10)25(23,24)18-5-6-19-13(8-18)15(21)17-12(9-20)16(19)22/h3-4,7,12-13,20H,5-6,8-9H2,1-2H3,(H,17,21)/t12-,13-/m1/s1 |
| InChIKey | RSGQVOCKLOGUGD-CHWSQXEVSA-N |
| XLogP | -1.00 |
| TPSA | 107.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.43 |
| LogP ≤ 5 | -1.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |