C14H20BrNO2S — CID 114801823
3-(2-bromoethyl)-1-(2,5-dimethylphenyl)sulfonylpyrrolidine (PubChem CID 114801823) has the molecular formula C14H20BrNO2S and a molecular weight of 346.29 g/mol. Its IUPAC name is 3-(2-bromoethyl)-1-(2,5-dimethylphenyl)sulfonylpyrrolidine.
| Compound Name | 3-(2-bromoethyl)-1-(2,5-dimethylphenyl)sulfonylpyrrolidine |
|---|---|
| PubChem CID | 114801823 |
| Molecular Formula | C14H20BrNO2S |
| Molecular Weight | 346.29 g/mol |
| Exact Mass | 345.04 |
| IUPAC Name | 3-(2-bromoethyl)-1-(2,5-dimethylphenyl)sulfonylpyrrolidine |
| SMILES | Cc1ccc(C)c(S(=O)(=O)N2CCC(CCBr)C2)c1 |
| InChI | InChI=1S/C14H20BrNO2S/c1-11-3-4-12(2)14(9-11)19(17,18)16-8-6-13(10-16)5-7-15/h3-4,9,13H,5-8,10H2,1-2H3 |
| InChIKey | XXCLQFFBSWBXMX-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.29 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|