C15H22BrN — CID 114800338
3-(2-bromoethyl)-1-[(2,5-dimethylphenyl)methyl]pyrrolidine (PubChem CID 114800338) has the molecular formula C15H22BrN and a molecular weight of 296.25 g/mol. Its IUPAC name is 3-(2-bromoethyl)-1-[(2,5-dimethylphenyl)methyl]pyrrolidine.
| Compound Name | 3-(2-bromoethyl)-1-[(2,5-dimethylphenyl)methyl]pyrrolidine |
|---|---|
| PubChem CID | 114800338 |
| Molecular Formula | C15H22BrN |
| Molecular Weight | 296.25 g/mol |
| Exact Mass | 295.09 |
| IUPAC Name | 3-(2-bromoethyl)-1-[(2,5-dimethylphenyl)methyl]pyrrolidine |
| SMILES | Cc1ccc(C)c(CN2CCC(CCBr)C2)c1 |
| InChI | InChI=1S/C15H22BrN/c1-12-3-4-13(2)15(9-12)11-17-8-6-14(10-17)5-7-16/h3-4,9,14H,5-8,10-11H2,1-2H3 |
| InChIKey | XEAODBRWLSGZLM-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.25 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|