C15H18FN3O5S — CID 56852350
(7S,9aR)-2-(2-fluorophenyl)sulfonyl-7-[(1R)-1-hydroxyethyl]-1,3,4,7,8,9a-hexahydropyrazino[1,2-a]pyrazine-6,9-dione (PubChem CID 56852350) has the molecular formula C15H18FN3O5S and a molecular weight of 371.39 g/mol. Its IUPAC name is (7S,9aR)-2-(2-fluorophenyl)sulfonyl-7-[(1R)-1-hydroxyethyl]-1,3,4,7,8,9a-hexahydropyrazino[1,2-a]pyrazine-6,9-dione.
| Compound Name | (7S,9aR)-2-(2-fluorophenyl)sulfonyl-7-[(1R)-1-hydroxyethyl]-1,3,4,7,8,9a-hexahydropyrazino[1,2-a]pyrazine-6,9-dione |
|---|---|
| PubChem CID | 56852350 |
| Molecular Formula | C15H18FN3O5S |
| Molecular Weight | 371.39 g/mol |
| Exact Mass | 371.10 |
| IUPAC Name | (7S,9aR)-2-(2-fluorophenyl)sulfonyl-7-[(1R)-1-hydroxyethyl]-1,3,4,7,8,9a-hexahydropyrazino[1,2-a]pyrazine-6,9-dione |
| SMILES | C[C@@H](O)[C@@H]1NC(=O)[C@H]2CN(S(=O)(=O)c3ccccc3F)CCN2C1=O |
| InChI | InChI=1S/C15H18FN3O5S/c1-9(20)13-15(22)19-7-6-18(8-11(19)14(21)17-13)25(23,24)12-5-3-2-4-10(12)16/h2-5,9,11,13,20H,6-8H2,1H3,(H,17,21)/t9-,11-,13+/m1/s1 |
| InChIKey | GVUCRZJDWGPWQK-XWIASGKRSA-N |
| XLogP | -1.09 |
| TPSA | 107.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.39 |
| LogP ≤ 5 | -1.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |