C15H24ClFN2O2S — CID 163331835
1-(2-fluorophenyl)sulfonyl-4-(3-methylbutyl)piperazine;hydrochloride (PubChem CID 163331835) has the molecular formula C15H24ClFN2O2S and a molecular weight of 350.89 g/mol. Its IUPAC name is 1-(2-fluorophenyl)sulfonyl-4-(3-methylbutyl)piperazine;hydrochloride.
| Compound Name | 1-(2-fluorophenyl)sulfonyl-4-(3-methylbutyl)piperazine;hydrochloride |
|---|---|
| PubChem CID | 163331835 |
| Molecular Formula | C15H24ClFN2O2S |
| Molecular Weight | 350.89 g/mol |
| Exact Mass | 350.12 |
| IUPAC Name | 1-(2-fluorophenyl)sulfonyl-4-(3-methylbutyl)piperazine;hydrochloride |
| SMILES | CC(C)CCN1CCN(S(=O)(=O)c2ccccc2F)CC1.Cl |
| InChI | InChI=1S/C15H23FN2O2S.ClH/c1-13(2)7-8-17-9-11-18(12-10-17)21(19,20)15-6-4-3-5-14(15)16;/h3-6,13H,7-12H2,1-2H3;1H |
| InChIKey | CALBEACWWGFQOR-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.89 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |