C17H23FN4O3S — CID 8690260
N-(2-cyanopropan-2-yl)-2-[4-(2-fluorophenyl)sulfonylpiperazin-1-yl]-N-methylacetamide (PubChem CID 8690260) has the molecular formula C17H23FN4O3S and a molecular weight of 382.46 g/mol. Its IUPAC name is N-(2-cyanopropan-2-yl)-2-[4-(2-fluorophenyl)sulfonylpiperazin-1-yl]-N-methylacetamide.
| Compound Name | N-(2-cyanopropan-2-yl)-2-[4-(2-fluorophenyl)sulfonylpiperazin-1-yl]-N-methylacetamide |
|---|---|
| PubChem CID | 8690260 |
| Molecular Formula | C17H23FN4O3S |
| Molecular Weight | 382.46 g/mol |
| Exact Mass | 382.15 |
| IUPAC Name | N-(2-cyanopropan-2-yl)-2-[4-(2-fluorophenyl)sulfonylpiperazin-1-yl]-N-methylacetamide |
| SMILES | CN(C(=O)CN1CCN(S(=O)(=O)c2ccccc2F)CC1)C(C)(C)C#N |
| InChI | InChI=1S/C17H23FN4O3S/c1-17(2,13-19)20(3)16(23)12-21-8-10-22(11-9-21)26(24,25)15-7-5-4-6-14(15)18/h4-7H,8-12H2,1-3H3 |
| InChIKey | VMBHDDAMRJIEHH-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 84.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.46 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |