C22H26N4O5S — CID 24581577
2-(4-benzyl-2,5-dioxoimidazolidin-1-yl)-N-[5-(dimethylsulfamoyl)-2,3-dimethylphenyl]acetamide (PubChem CID 24581577) has the molecular formula C22H26N4O5S and a molecular weight of 458.54 g/mol. Its IUPAC name is 2-(4-benzyl-2,5-dioxoimidazolidin-1-yl)-N-[5-(dimethylsulfamoyl)-2,3-dimethylphenyl]acetamide.
| Compound Name | 2-(4-benzyl-2,5-dioxoimidazolidin-1-yl)-N-[5-(dimethylsulfamoyl)-2,3-dimethylphenyl]acetamide |
|---|---|
| PubChem CID | 24581577 |
| Molecular Formula | C22H26N4O5S |
| Molecular Weight | 458.54 g/mol |
| Exact Mass | 458.16 |
| IUPAC Name | 2-(4-benzyl-2,5-dioxoimidazolidin-1-yl)-N-[5-(dimethylsulfamoyl)-2,3-dimethylphenyl]acetamide |
| SMILES | Cc1cc(S(=O)(=O)N(C)C)cc(NC(=O)CN2C(=O)NC(Cc3ccccc3)C2=O)c1C |
| InChI | InChI=1S/C22H26N4O5S/c1-14-10-17(32(30,31)25(3)4)12-18(15(14)2)23-20(27)13-26-21(28)19(24-22(26)29)11-16-8-6-5-7-9-16/h5-10,12,19H,11,13H2,1-4H3,(H,23,27)(H,24,29) |
| InChIKey | FXFNHQKVSGYPGX-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 115.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.54 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|