C22H23ClN4O6S — CID 25361483
2-[(4S)-4-benzyl-2,5-dioxoimidazolidin-1-yl]-N-(2-chloro-5-morpholin-4-ylsulfonylphenyl)acetamide (PubChem CID 25361483) has the molecular formula C22H23ClN4O6S and a molecular weight of 506.97 g/mol. Its IUPAC name is 2-[(4S)-4-benzyl-2,5-dioxoimidazolidin-1-yl]-N-(2-chloro-5-morpholin-4-ylsulfonylphenyl)acetamide.
| Compound Name | 2-[(4S)-4-benzyl-2,5-dioxoimidazolidin-1-yl]-N-(2-chloro-5-morpholin-4-ylsulfonylphenyl)acetamide |
|---|---|
| PubChem CID | 25361483 |
| Molecular Formula | C22H23ClN4O6S |
| Molecular Weight | 506.97 g/mol |
| Exact Mass | 506.10 |
| IUPAC Name | 2-[(4S)-4-benzyl-2,5-dioxoimidazolidin-1-yl]-N-(2-chloro-5-morpholin-4-ylsulfonylphenyl)acetamide |
| SMILES | O=C(CN1C(=O)N[C@@H](Cc2ccccc2)C1=O)Nc1cc(S(=O)(=O)N2CCOCC2)ccc1Cl |
| InChI | InChI=1S/C22H23ClN4O6S/c23-17-7-6-16(34(31,32)26-8-10-33-11-9-26)13-18(17)24-20(28)14-27-21(29)19(25-22(27)30)12-15-4-2-1-3-5-15/h1-7,13,19H,8-12,14H2,(H,24,28)(H,25,30)/t19-/m0/s1 |
| InChIKey | SIUGFKHNYHTVGI-IBGZPJMESA-N |
| XLogP | 1.46 |
| TPSA | 125.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.97 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|