C22H25ClN4O5S — CID 108876509
1-(1-benzyl-5-oxopyrrolidin-3-yl)-3-(2-chloro-5-morpholin-4-ylsulfonylphenyl)urea (PubChem CID 108876509) has the molecular formula C22H25ClN4O5S and a molecular weight of 492.99 g/mol. Its IUPAC name is 1-(1-benzyl-5-oxopyrrolidin-3-yl)-3-(2-chloro-5-morpholin-4-ylsulfonylphenyl)urea.
| Compound Name | 1-(1-benzyl-5-oxopyrrolidin-3-yl)-3-(2-chloro-5-morpholin-4-ylsulfonylphenyl)urea |
|---|---|
| PubChem CID | 108876509 |
| Molecular Formula | C22H25ClN4O5S |
| Molecular Weight | 492.99 g/mol |
| Exact Mass | 492.12 |
| IUPAC Name | 1-(1-benzyl-5-oxopyrrolidin-3-yl)-3-(2-chloro-5-morpholin-4-ylsulfonylphenyl)urea |
| SMILES | O=C(Nc1cc(S(=O)(=O)N2CCOCC2)ccc1Cl)NC1CC(=O)N(Cc2ccccc2)C1 |
| InChI | InChI=1S/C22H25ClN4O5S/c23-19-7-6-18(33(30,31)27-8-10-32-11-9-27)13-20(19)25-22(29)24-17-12-21(28)26(15-17)14-16-4-2-1-3-5-16/h1-7,13,17H,8-12,14-15H2,(H2,24,25,29) |
| InChIKey | VWAPYJVFMYXVAJ-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 108.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.99 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |