C23H28N4O4S — CID 108876723
N-(1-benzyl-5-oxopyrrolidin-3-yl)-4-(4-methylphenyl)sulfonylpiperazine-1-carboxamide (PubChem CID 108876723) has the molecular formula C23H28N4O4S and a molecular weight of 456.57 g/mol. Its IUPAC name is N-(1-benzyl-5-oxopyrrolidin-3-yl)-4-(4-methylphenyl)sulfonylpiperazine-1-carboxamide.
| Compound Name | N-(1-benzyl-5-oxopyrrolidin-3-yl)-4-(4-methylphenyl)sulfonylpiperazine-1-carboxamide |
|---|---|
| PubChem CID | 108876723 |
| Molecular Formula | C23H28N4O4S |
| Molecular Weight | 456.57 g/mol |
| Exact Mass | 456.18 |
| IUPAC Name | N-(1-benzyl-5-oxopyrrolidin-3-yl)-4-(4-methylphenyl)sulfonylpiperazine-1-carboxamide |
| SMILES | Cc1ccc(S(=O)(=O)N2CCN(C(=O)NC3CC(=O)N(Cc4ccccc4)C3)CC2)cc1 |
| InChI | InChI=1S/C23H28N4O4S/c1-18-7-9-21(10-8-18)32(30,31)27-13-11-25(12-14-27)23(29)24-20-15-22(28)26(17-20)16-19-5-3-2-4-6-19/h2-10,20H,11-17H2,1H3,(H,24,29) |
| InChIKey | HLQAVLSOUIBBBP-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 90.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.57 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |