C18H17F2N3O2 — CID 108876524
1-(1-benzyl-5-oxopyrrolidin-3-yl)-3-(2,6-difluorophenyl)urea (PubChem CID 108876524) has the molecular formula C18H17F2N3O2 and a molecular weight of 345.35 g/mol. Its IUPAC name is 1-(1-benzyl-5-oxopyrrolidin-3-yl)-3-(2,6-difluorophenyl)urea.
| Compound Name | 1-(1-benzyl-5-oxopyrrolidin-3-yl)-3-(2,6-difluorophenyl)urea |
|---|---|
| PubChem CID | 108876524 |
| Molecular Formula | C18H17F2N3O2 |
| Molecular Weight | 345.35 g/mol |
| Exact Mass | 345.13 |
| IUPAC Name | 1-(1-benzyl-5-oxopyrrolidin-3-yl)-3-(2,6-difluorophenyl)urea |
| SMILES | O=C(Nc1c(F)cccc1F)NC1CC(=O)N(Cc2ccccc2)C1 |
| InChI | InChI=1S/C18H17F2N3O2/c19-14-7-4-8-15(20)17(14)22-18(25)21-13-9-16(24)23(11-13)10-12-5-2-1-3-6-12/h1-8,13H,9-11H2,(H2,21,22,25) |
| InChIKey | HOUMKUXHHMYEOZ-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.35 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |