C18H18BrN3O2 — CID 108876636
1-(1-benzyl-5-oxopyrrolidin-3-yl)-3-(2-bromophenyl)urea (PubChem CID 108876636) has the molecular formula C18H18BrN3O2 and a molecular weight of 388.27 g/mol. Its IUPAC name is 1-(1-benzyl-5-oxopyrrolidin-3-yl)-3-(2-bromophenyl)urea.
| Compound Name | 1-(1-benzyl-5-oxopyrrolidin-3-yl)-3-(2-bromophenyl)urea |
|---|---|
| PubChem CID | 108876636 |
| Molecular Formula | C18H18BrN3O2 |
| Molecular Weight | 388.27 g/mol |
| Exact Mass | 387.06 |
| IUPAC Name | 1-(1-benzyl-5-oxopyrrolidin-3-yl)-3-(2-bromophenyl)urea |
| SMILES | O=C(Nc1ccccc1Br)NC1CC(=O)N(Cc2ccccc2)C1 |
| InChI | InChI=1S/C18H18BrN3O2/c19-15-8-4-5-9-16(15)21-18(24)20-14-10-17(23)22(12-14)11-13-6-2-1-3-7-13/h1-9,14H,10-12H2,(H2,20,21,24) |
| InChIKey | NVBXMEPKZZDFIH-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.27 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |