C20H24N4O2 — CID 97275872
1-[(3S)-1-benzyl-5-oxopyrrolidin-3-yl]-3-(2,4,6-trimethyl-3-pyridinyl)urea (PubChem CID 97275872) has the molecular formula C20H24N4O2 and a molecular weight of 352.44 g/mol. Its IUPAC name is 1-[(3S)-1-benzyl-5-oxopyrrolidin-3-yl]-3-(2,4,6-trimethyl-3-pyridinyl)urea.
| Compound Name | 1-[(3S)-1-benzyl-5-oxopyrrolidin-3-yl]-3-(2,4,6-trimethyl-3-pyridinyl)urea |
|---|---|
| PubChem CID | 97275872 |
| Molecular Formula | C20H24N4O2 |
| Molecular Weight | 352.44 g/mol |
| Exact Mass | 352.19 |
| IUPAC Name | 1-[(3S)-1-benzyl-5-oxopyrrolidin-3-yl]-3-(2,4,6-trimethyl-3-pyridinyl)urea |
| SMILES | Cc1cc(C)c(NC(=O)N[C@H]2CC(=O)N(Cc3ccccc3)C2)c(C)n1 |
| InChI | InChI=1S/C20H24N4O2/c1-13-9-14(2)21-15(3)19(13)23-20(26)22-17-10-18(25)24(12-17)11-16-7-5-4-6-8-16/h4-9,17H,10-12H2,1-3H3,(H2,22,23,26)/t17-/m0/s1 |
| InChIKey | HYHQXFCACDIKTA-KRWDZBQOSA-N |
| XLogP | 2.93 |
| TPSA | 74.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.44 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |