C22H23ClN4O5S — CID 40985035
2-[(4R)-4-benzyl-2,5-dioxoimidazolidin-1-yl]-N-(2-chloro-5-pyrrolidin-1-ylsulfonylphenyl)acetamide (PubChem CID 40985035) has the molecular formula C22H23ClN4O5S and a molecular weight of 490.97 g/mol. Its IUPAC name is 2-[(4R)-4-benzyl-2,5-dioxoimidazolidin-1-yl]-N-(2-chloro-5-pyrrolidin-1-ylsulfonylphenyl)acetamide.
| Compound Name | 2-[(4R)-4-benzyl-2,5-dioxoimidazolidin-1-yl]-N-(2-chloro-5-pyrrolidin-1-ylsulfonylphenyl)acetamide |
|---|---|
| PubChem CID | 40985035 |
| Molecular Formula | C22H23ClN4O5S |
| Molecular Weight | 490.97 g/mol |
| Exact Mass | 490.11 |
| IUPAC Name | 2-[(4R)-4-benzyl-2,5-dioxoimidazolidin-1-yl]-N-(2-chloro-5-pyrrolidin-1-ylsulfonylphenyl)acetamide |
| SMILES | O=C(CN1C(=O)N[C@H](Cc2ccccc2)C1=O)Nc1cc(S(=O)(=O)N2CCCC2)ccc1Cl |
| InChI | InChI=1S/C22H23ClN4O5S/c23-17-9-8-16(33(31,32)26-10-4-5-11-26)13-18(17)24-20(28)14-27-21(29)19(25-22(27)30)12-15-6-2-1-3-7-15/h1-3,6-9,13,19H,4-5,10-12,14H2,(H,24,28)(H,25,30)/t19-/m1/s1 |
| InChIKey | WLZWPEZWXDEZDK-LJQANCHMSA-N |
| XLogP | 2.23 |
| TPSA | 115.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.97 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|