C20H21N3O5 — CID 2602148
2-[(4R)-4-benzyl-2,5-dioxoimidazolidin-1-yl]-N-(3,4-dimethoxyphenyl)acetamide (PubChem CID 2602148) has the molecular formula C20H21N3O5 and a molecular weight of 383.40 g/mol. Its IUPAC name is 2-[(4R)-4-benzyl-2,5-dioxoimidazolidin-1-yl]-N-(3,4-dimethoxyphenyl)acetamide.
| Compound Name | 2-[(4R)-4-benzyl-2,5-dioxoimidazolidin-1-yl]-N-(3,4-dimethoxyphenyl)acetamide |
|---|---|
| PubChem CID | 2602148 |
| Molecular Formula | C20H21N3O5 |
| Molecular Weight | 383.40 g/mol |
| Exact Mass | 383.15 |
| IUPAC Name | 2-[(4R)-4-benzyl-2,5-dioxoimidazolidin-1-yl]-N-(3,4-dimethoxyphenyl)acetamide |
| SMILES | COc1ccc(NC(=O)CN2C(=O)N[C@H](Cc3ccccc3)C2=O)cc1OC |
| InChI | InChI=1S/C20H21N3O5/c1-27-16-9-8-14(11-17(16)28-2)21-18(24)12-23-19(25)15(22-20(23)26)10-13-6-4-3-5-7-13/h3-9,11,15H,10,12H2,1-2H3,(H,21,24)(H,22,26)/t15-/m1/s1 |
| InChIKey | BQJGBKAXKJTOOI-OAHLLOKOSA-N |
| XLogP | 1.81 |
| TPSA | 96.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.40 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|