C26H25N3O3S — CID 41117633
2-[(4S)-4-benzyl-2,5-dioxoimidazolidin-1-yl]-N-[4-(2,5-dimethylphenyl)sulfanylphenyl]acetamide (PubChem CID 41117633) has the molecular formula C26H25N3O3S and a molecular weight of 459.57 g/mol. Its IUPAC name is 2-[(4S)-4-benzyl-2,5-dioxoimidazolidin-1-yl]-N-[4-(2,5-dimethylphenyl)sulfanylphenyl]acetamide.
| Compound Name | 2-[(4S)-4-benzyl-2,5-dioxoimidazolidin-1-yl]-N-[4-(2,5-dimethylphenyl)sulfanylphenyl]acetamide |
|---|---|
| PubChem CID | 41117633 |
| Molecular Formula | C26H25N3O3S |
| Molecular Weight | 459.57 g/mol |
| Exact Mass | 459.16 |
| IUPAC Name | 2-[(4S)-4-benzyl-2,5-dioxoimidazolidin-1-yl]-N-[4-(2,5-dimethylphenyl)sulfanylphenyl]acetamide |
| SMILES | Cc1ccc(C)c(Sc2ccc(NC(=O)CN3C(=O)N[C@@H](Cc4ccccc4)C3=O)cc2)c1 |
| InChI | InChI=1S/C26H25N3O3S/c1-17-8-9-18(2)23(14-17)33-21-12-10-20(11-13-21)27-24(30)16-29-25(31)22(28-26(29)32)15-19-6-4-3-5-7-19/h3-14,22H,15-16H2,1-2H3,(H,27,30)(H,28,32)/t22-/m0/s1 |
| InChIKey | SYGQFESEKZFJRU-QFIPXVFZSA-N |
| XLogP | 4.56 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.57 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|