C24H30N3O4S+ — CID 2417285
(3R)-3-[4-(3,4-dimethylphenyl)sulfonylpiperazin-1-ium-1-yl]-1-(2-phenylethyl)pyrrolidine-2,5-dione (PubChem CID 2417285) has the molecular formula C24H30N3O4S+ and a molecular weight of 456.59 g/mol. Its IUPAC name is (3R)-3-[4-(3,4-dimethylphenyl)sulfonylpiperazin-1-ium-1-yl]-1-(2-phenylethyl)pyrrolidine-2,5-dione.
| Compound Name | (3R)-3-[4-(3,4-dimethylphenyl)sulfonylpiperazin-1-ium-1-yl]-1-(2-phenylethyl)pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 2417285 |
| Molecular Formula | C24H30N3O4S+ |
| Molecular Weight | 456.59 g/mol |
| Exact Mass | 456.20 |
| IUPAC Name | (3R)-3-[4-(3,4-dimethylphenyl)sulfonylpiperazin-1-ium-1-yl]-1-(2-phenylethyl)pyrrolidine-2,5-dione |
| SMILES | Cc1ccc(S(=O)(=O)N2CC[NH+]([C@@H]3CC(=O)N(CCc4ccccc4)C3=O)CC2)cc1C |
| InChI | InChI=1S/C24H29N3O4S/c1-18-8-9-21(16-19(18)2)32(30,31)26-14-12-25(13-15-26)22-17-23(28)27(24(22)29)11-10-20-6-4-3-5-7-20/h3-9,16,22H,10-15,17H2,1-2H3/p+1/t22-/m1/s1 |
| InChIKey | XCLXRMCOQFFYSP-JOCHJYFZSA-O |
| XLogP | 0.56 |
| TPSA | 79.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.59 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|