C20H24N5O2+ — CID 7241534
(3R)-1-(2-phenylethyl)-3-(4-pyrimidin-2-ylpiperazin-1-ium-1-yl)pyrrolidine-2,5-dione (PubChem CID 7241534) has the molecular formula C20H24N5O2+ and a molecular weight of 366.44 g/mol. Its IUPAC name is (3R)-1-(2-phenylethyl)-3-(4-pyrimidin-2-ylpiperazin-1-ium-1-yl)pyrrolidine-2,5-dione.
| Compound Name | (3R)-1-(2-phenylethyl)-3-(4-pyrimidin-2-ylpiperazin-1-ium-1-yl)pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 7241534 |
| Molecular Formula | C20H24N5O2+ |
| Molecular Weight | 366.44 g/mol |
| Exact Mass | 366.19 |
| IUPAC Name | (3R)-1-(2-phenylethyl)-3-(4-pyrimidin-2-ylpiperazin-1-ium-1-yl)pyrrolidine-2,5-dione |
| SMILES | O=C1C[C@@H]([NH+]2CCN(c3ncccn3)CC2)C(=O)N1CCc1ccccc1 |
| InChI | InChI=1S/C20H23N5O2/c26-18-15-17(19(27)25(18)10-7-16-5-2-1-3-6-16)23-11-13-24(14-12-23)20-21-8-4-9-22-20/h1-6,8-9,17H,7,10-15H2/p+1/t17-/m1/s1 |
| InChIKey | XSNZZZSKFINTMF-QGZVFWFLSA-O |
| XLogP | -0.45 |
| TPSA | 70.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.44 |
| LogP ≤ 5 | -0.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|