C23H30N4O4+2 — CID 6965558
(3R)-1-[2-(3,4-dimethoxyphenyl)ethyl]-3-(4-pyridin-1-ium-2-ylpiperazin-1-ium-1-yl)pyrrolidine-2,5-dione (PubChem CID 6965558) has the molecular formula C23H30N4O4+2 and a molecular weight of 426.52 g/mol. Its IUPAC name is (3R)-1-[2-(3,4-dimethoxyphenyl)ethyl]-3-(4-pyridin-1-ium-2-ylpiperazin-1-ium-1-yl)pyrrolidine-2,5-dione.
| Compound Name | (3R)-1-[2-(3,4-dimethoxyphenyl)ethyl]-3-(4-pyridin-1-ium-2-ylpiperazin-1-ium-1-yl)pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 6965558 |
| Molecular Formula | C23H30N4O4+2 |
| Molecular Weight | 426.52 g/mol |
| Exact Mass | 426.23 |
| IUPAC Name | (3R)-1-[2-(3,4-dimethoxyphenyl)ethyl]-3-(4-pyridin-1-ium-2-ylpiperazin-1-ium-1-yl)pyrrolidine-2,5-dione |
| SMILES | COc1ccc(CCN2C(=O)C[C@@H]([NH+]3CCN(c4cccc[nH+]4)CC3)C2=O)cc1OC |
| InChI | InChI=1S/C23H28N4O4/c1-30-19-7-6-17(15-20(19)31-2)8-10-27-22(28)16-18(23(27)29)25-11-13-26(14-12-25)21-5-3-4-9-24-21/h3-7,9,15,18H,8,10-14,16H2,1-2H3/p+2/t18-/m1/s1 |
| InChIKey | ITYBBGVECHLGBK-GOSISDBHSA-P |
| XLogP | -0.41 |
| TPSA | 77.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.52 |
| LogP ≤ 5 | -0.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|