C23H30N4O3+2 — CID 7118683
(3S)-1-(4-butoxyphenyl)-3-(4-pyridin-1-ium-2-ylpiperazin-1-ium-1-yl)pyrrolidine-2,5-dione (PubChem CID 7118683) has the molecular formula C23H30N4O3+2 and a molecular weight of 410.52 g/mol. Its IUPAC name is (3S)-1-(4-butoxyphenyl)-3-(4-pyridin-1-ium-2-ylpiperazin-1-ium-1-yl)pyrrolidine-2,5-dione.
| Compound Name | (3S)-1-(4-butoxyphenyl)-3-(4-pyridin-1-ium-2-ylpiperazin-1-ium-1-yl)pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 7118683 |
| Molecular Formula | C23H30N4O3+2 |
| Molecular Weight | 410.52 g/mol |
| Exact Mass | 410.23 |
| IUPAC Name | (3S)-1-(4-butoxyphenyl)-3-(4-pyridin-1-ium-2-ylpiperazin-1-ium-1-yl)pyrrolidine-2,5-dione |
| SMILES | CCCCOc1ccc(N2C(=O)C[C@H]([NH+]3CCN(c4cccc[nH+]4)CC3)C2=O)cc1 |
| InChI | InChI=1S/C23H28N4O3/c1-2-3-16-30-19-9-7-18(8-10-19)27-22(28)17-20(23(27)29)25-12-14-26(15-13-25)21-6-4-5-11-24-21/h4-11,20H,2-3,12-17H2,1H3/p+2/t20-/m0/s1 |
| InChIKey | OHYQEXRZIBLYKP-FQEVSTJZSA-P |
| XLogP | 0.72 |
| TPSA | 68.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.52 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|