C25H31N3O3+2 — CID 7381025
(3S)-3-[4-[(E)-2-phenylethenyl]piperazine-1,4-diium-1-yl]-1-(4-propoxyphenyl)pyrrolidine-2,5-dione (PubChem CID 7381025) has the molecular formula C25H31N3O3+2 and a molecular weight of 421.54 g/mol. Its IUPAC name is (3S)-3-[4-[(E)-2-phenylethenyl]piperazine-1,4-diium-1-yl]-1-(4-propoxyphenyl)pyrrolidine-2,5-dione.
| Compound Name | (3S)-3-[4-[(E)-2-phenylethenyl]piperazine-1,4-diium-1-yl]-1-(4-propoxyphenyl)pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 7381025 |
| Molecular Formula | C25H31N3O3+2 |
| Molecular Weight | 421.54 g/mol |
| Exact Mass | 421.24 |
| IUPAC Name | (3S)-3-[4-[(E)-2-phenylethenyl]piperazine-1,4-diium-1-yl]-1-(4-propoxyphenyl)pyrrolidine-2,5-dione |
| SMILES | CCCOc1ccc(N2C(=O)C[C@H]([NH+]3CC[NH+](/C=C/c4ccccc4)CC3)C2=O)cc1 |
| InChI | InChI=1S/C25H29N3O3/c1-2-18-31-22-10-8-21(9-11-22)28-24(29)19-23(25(28)30)27-16-14-26(15-17-27)13-12-20-6-4-3-5-7-20/h3-13,23H,2,14-19H2,1H3/p+2/b13-12+/t23-/m0/s1 |
| InChIKey | WRJYASKCAQIGLQ-OTOIZHKDSA-P |
| XLogP | 0.56 |
| TPSA | 55.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.54 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|