C23H28N3O4+ — CID 2417275
(3R)-3-[4-(4-hydroxyphenyl)piperazin-1-ium-1-yl]-1-(4-propoxyphenyl)pyrrolidine-2,5-dione (PubChem CID 2417275) has the molecular formula C23H28N3O4+ and a molecular weight of 410.49 g/mol. Its IUPAC name is (3R)-3-[4-(4-hydroxyphenyl)piperazin-1-ium-1-yl]-1-(4-propoxyphenyl)pyrrolidine-2,5-dione.
| Compound Name | (3R)-3-[4-(4-hydroxyphenyl)piperazin-1-ium-1-yl]-1-(4-propoxyphenyl)pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 2417275 |
| Molecular Formula | C23H28N3O4+ |
| Molecular Weight | 410.49 g/mol |
| Exact Mass | 410.21 |
| IUPAC Name | (3R)-3-[4-(4-hydroxyphenyl)piperazin-1-ium-1-yl]-1-(4-propoxyphenyl)pyrrolidine-2,5-dione |
| SMILES | CCCOc1ccc(N2C(=O)C[C@@H]([NH+]3CCN(c4ccc(O)cc4)CC3)C2=O)cc1 |
| InChI | InChI=1S/C23H27N3O4/c1-2-15-30-20-9-5-18(6-10-20)26-22(28)16-21(23(26)29)25-13-11-24(12-14-25)17-3-7-19(27)8-4-17/h3-10,21,27H,2,11-16H2,1H3/p+1/t21-/m1/s1 |
| InChIKey | XCDVUMWSGFJXQX-OAQYLSRUSA-O |
| XLogP | 1.22 |
| TPSA | 74.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.49 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|