C20H23ClN4O2+2 — CID 6968719
(3R)-1-(3-chloro-4-methylphenyl)-3-(4-pyridin-1-ium-2-ylpiperazin-1-ium-1-yl)pyrrolidine-2,5-dione (PubChem CID 6968719) has the molecular formula C20H23ClN4O2+2 and a molecular weight of 386.88 g/mol. Its IUPAC name is (3R)-1-(3-chloro-4-methylphenyl)-3-(4-pyridin-1-ium-2-ylpiperazin-1-ium-1-yl)pyrrolidine-2,5-dione.
| Compound Name | (3R)-1-(3-chloro-4-methylphenyl)-3-(4-pyridin-1-ium-2-ylpiperazin-1-ium-1-yl)pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 6968719 |
| Molecular Formula | C20H23ClN4O2+2 |
| Molecular Weight | 386.88 g/mol |
| Exact Mass | 386.15 |
| IUPAC Name | (3R)-1-(3-chloro-4-methylphenyl)-3-(4-pyridin-1-ium-2-ylpiperazin-1-ium-1-yl)pyrrolidine-2,5-dione |
| SMILES | Cc1ccc(N2C(=O)C[C@@H]([NH+]3CCN(c4cccc[nH+]4)CC3)C2=O)cc1Cl |
| InChI | InChI=1S/C20H21ClN4O2/c1-14-5-6-15(12-16(14)21)25-19(26)13-17(20(25)27)23-8-10-24(11-9-23)18-4-2-3-7-22-18/h2-7,12,17H,8-11,13H2,1H3/p+2/t17-/m1/s1 |
| InChIKey | NPKQUJKSGZRXJZ-QGZVFWFLSA-P |
| XLogP | 0.50 |
| TPSA | 59.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.88 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|