C23H24ClN4O2+ — CID 6988132
(3S)-3-[4-(1H-benzimidazol-2-yl)piperidin-1-ium-1-yl]-1-(3-chloro-4-methylphenyl)pyrrolidine-2,5-dione (PubChem CID 6988132) has the molecular formula C23H24ClN4O2+ and a molecular weight of 423.92 g/mol. Its IUPAC name is (3S)-3-[4-(1H-benzimidazol-2-yl)piperidin-1-ium-1-yl]-1-(3-chloro-4-methylphenyl)pyrrolidine-2,5-dione.
| Compound Name | (3S)-3-[4-(1H-benzimidazol-2-yl)piperidin-1-ium-1-yl]-1-(3-chloro-4-methylphenyl)pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 6988132 |
| Molecular Formula | C23H24ClN4O2+ |
| Molecular Weight | 423.92 g/mol |
| Exact Mass | 423.16 |
| IUPAC Name | (3S)-3-[4-(1H-benzimidazol-2-yl)piperidin-1-ium-1-yl]-1-(3-chloro-4-methylphenyl)pyrrolidine-2,5-dione |
| SMILES | Cc1ccc(N2C(=O)C[C@H]([NH+]3CCC(c4nc5ccccc5[nH]4)CC3)C2=O)cc1Cl |
| InChI | InChI=1S/C23H23ClN4O2/c1-14-6-7-16(12-17(14)24)28-21(29)13-20(23(28)30)27-10-8-15(9-11-27)22-25-18-4-2-3-5-19(18)26-22/h2-7,12,15,20H,8-11,13H2,1H3,(H,25,26)/p+1/t20-/m0/s1 |
| InChIKey | FBSOWEJFGRVSIS-FQEVSTJZSA-O |
| XLogP | 2.62 |
| TPSA | 70.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.92 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|