C23H25N4O2+ — CID 6988133
(3R)-3-[4-(1H-benzimidazol-2-yl)piperidin-1-ium-1-yl]-1-(3-methylphenyl)pyrrolidine-2,5-dione (PubChem CID 6988133) has the molecular formula C23H25N4O2+ and a molecular weight of 389.48 g/mol. Its IUPAC name is (3R)-3-[4-(1H-benzimidazol-2-yl)piperidin-1-ium-1-yl]-1-(3-methylphenyl)pyrrolidine-2,5-dione.
| Compound Name | (3R)-3-[4-(1H-benzimidazol-2-yl)piperidin-1-ium-1-yl]-1-(3-methylphenyl)pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 6988133 |
| Molecular Formula | C23H25N4O2+ |
| Molecular Weight | 389.48 g/mol |
| Exact Mass | 389.20 |
| IUPAC Name | (3R)-3-[4-(1H-benzimidazol-2-yl)piperidin-1-ium-1-yl]-1-(3-methylphenyl)pyrrolidine-2,5-dione |
| SMILES | Cc1cccc(N2C(=O)C[C@@H]([NH+]3CCC(c4nc5ccccc5[nH]4)CC3)C2=O)c1 |
| InChI | InChI=1S/C23H24N4O2/c1-15-5-4-6-17(13-15)27-21(28)14-20(23(27)29)26-11-9-16(10-12-26)22-24-18-7-2-3-8-19(18)25-22/h2-8,13,16,20H,9-12,14H2,1H3,(H,24,25)/p+1/t20-/m1/s1 |
| InChIKey | JNEYKSIBCOWMDE-HXUWFJFHSA-O |
| XLogP | 1.97 |
| TPSA | 70.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.48 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|