C22H26ClN3O2+2 — CID 7190918
(3R)-3-[4-[(4-chlorophenyl)methyl]piperazine-1,4-diium-1-yl]-1-(3-methylphenyl)pyrrolidine-2,5-dione (PubChem CID 7190918) has the molecular formula C22H26ClN3O2+2 and a molecular weight of 399.92 g/mol. Its IUPAC name is (3R)-3-[4-[(4-chlorophenyl)methyl]piperazine-1,4-diium-1-yl]-1-(3-methylphenyl)pyrrolidine-2,5-dione.
| Compound Name | (3R)-3-[4-[(4-chlorophenyl)methyl]piperazine-1,4-diium-1-yl]-1-(3-methylphenyl)pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 7190918 |
| Molecular Formula | C22H26ClN3O2+2 |
| Molecular Weight | 399.92 g/mol |
| Exact Mass | 399.17 |
| IUPAC Name | (3R)-3-[4-[(4-chlorophenyl)methyl]piperazine-1,4-diium-1-yl]-1-(3-methylphenyl)pyrrolidine-2,5-dione |
| SMILES | Cc1cccc(N2C(=O)C[C@@H]([NH+]3CC[NH+](Cc4ccc(Cl)cc4)CC3)C2=O)c1 |
| InChI | InChI=1S/C22H24ClN3O2/c1-16-3-2-4-19(13-16)26-21(27)14-20(22(26)28)25-11-9-24(10-12-25)15-17-5-7-18(23)8-6-17/h2-8,13,20H,9-12,14-15H2,1H3/p+2/t20-/m1/s1 |
| InChIKey | GWMVWYCSNCNPMB-HXUWFJFHSA-P |
| XLogP | 0.26 |
| TPSA | 46.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.92 |
| LogP ≤ 5 | 0.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|