C22H23Cl2N3O4+2 — CID 6959849
(3S)-3-[4-(1,3-benzodioxol-5-ylmethyl)piperazine-1,4-diium-1-yl]-1-(3,5-dichlorophenyl)pyrrolidine-2,5-dione (PubChem CID 6959849) has the molecular formula C22H23Cl2N3O4+2 and a molecular weight of 464.35 g/mol. Its IUPAC name is (3S)-3-[4-(1,3-benzodioxol-5-ylmethyl)piperazine-1,4-diium-1-yl]-1-(3,5-dichlorophenyl)pyrrolidine-2,5-dione.
| Compound Name | (3S)-3-[4-(1,3-benzodioxol-5-ylmethyl)piperazine-1,4-diium-1-yl]-1-(3,5-dichlorophenyl)pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 6959849 |
| Molecular Formula | C22H23Cl2N3O4+2 |
| Molecular Weight | 464.35 g/mol |
| Exact Mass | 463.11 |
| IUPAC Name | (3S)-3-[4-(1,3-benzodioxol-5-ylmethyl)piperazine-1,4-diium-1-yl]-1-(3,5-dichlorophenyl)pyrrolidine-2,5-dione |
| SMILES | O=C1C[C@H]([NH+]2CC[NH+](Cc3ccc4c(c3)OCO4)CC2)C(=O)N1c1cc(Cl)cc(Cl)c1 |
| InChI | InChI=1S/C22H21Cl2N3O4/c23-15-8-16(24)10-17(9-15)27-21(28)11-18(22(27)29)26-5-3-25(4-6-26)12-14-1-2-19-20(7-14)31-13-30-19/h1-2,7-10,18H,3-6,11-13H2/p+2/t18-/m0/s1 |
| InChIKey | IEYGGLGDRZBXRO-SFHVURJKSA-P |
| XLogP | 0.34 |
| TPSA | 64.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.35 |
| LogP ≤ 5 | 0.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|