C18H25N3O4+2 — CID 6925133
(3R)-3-[4-(1,3-benzodioxol-5-ylmethyl)piperazine-1,4-diium-1-yl]-1-ethylpyrrolidine-2,5-dione (PubChem CID 6925133) has the molecular formula C18H25N3O4+2 and a molecular weight of 347.42 g/mol. Its IUPAC name is (3R)-3-[4-(1,3-benzodioxol-5-ylmethyl)piperazine-1,4-diium-1-yl]-1-ethylpyrrolidine-2,5-dione.
| Compound Name | (3R)-3-[4-(1,3-benzodioxol-5-ylmethyl)piperazine-1,4-diium-1-yl]-1-ethylpyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 6925133 |
| Molecular Formula | C18H25N3O4+2 |
| Molecular Weight | 347.42 g/mol |
| Exact Mass | 347.18 |
| IUPAC Name | (3R)-3-[4-(1,3-benzodioxol-5-ylmethyl)piperazine-1,4-diium-1-yl]-1-ethylpyrrolidine-2,5-dione |
| SMILES | CCN1C(=O)C[C@@H]([NH+]2CC[NH+](Cc3ccc4c(c3)OCO4)CC2)C1=O |
| InChI | InChI=1S/C18H23N3O4/c1-2-21-17(22)10-14(18(21)23)20-7-5-19(6-8-20)11-13-3-4-15-16(9-13)25-12-24-15/h3-4,9,14H,2,5-8,10-12H2,1H3/p+2/t14-/m1/s1 |
| InChIKey | XNJOSZLDMOGMNH-CQSZACIVSA-P |
| XLogP | -2.15 |
| TPSA | 64.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.42 |
| LogP ≤ 5 | -2.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|