C14H17N2O4+ — CID 2242855
1,3-benzodioxol-5-ylmethyl-[(3S)-1-ethyl-2,5-dioxopyrrolidin-3-yl]azanium (PubChem CID 2242855) has the molecular formula C14H17N2O4+ and a molecular weight of 277.30 g/mol. Its IUPAC name is 1,3-benzodioxol-5-ylmethyl-[(3S)-1-ethyl-2,5-dioxopyrrolidin-3-yl]azanium.
| Compound Name | 1,3-benzodioxol-5-ylmethyl-[(3S)-1-ethyl-2,5-dioxopyrrolidin-3-yl]azanium |
|---|---|
| PubChem CID | 2242855 |
| Molecular Formula | C14H17N2O4+ |
| Molecular Weight | 277.30 g/mol |
| Exact Mass | 277.12 |
| IUPAC Name | 1,3-benzodioxol-5-ylmethyl-[(3S)-1-ethyl-2,5-dioxopyrrolidin-3-yl]azanium |
| SMILES | CCN1C(=O)C[C@H]([NH2+]Cc2ccc3c(c2)OCO3)C1=O |
| InChI | InChI=1S/C14H16N2O4/c1-2-16-13(17)6-10(14(16)18)15-7-9-3-4-11-12(5-9)20-8-19-11/h3-5,10,15H,2,6-8H2,1H3/p+1/t10-/m0/s1 |
| InChIKey | REPRPNKAUBDOTB-JTQLQIEISA-O |
| XLogP | -0.37 |
| TPSA | 72.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.30 |
| LogP ≤ 5 | -0.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|