C19H17N2O6+ — CID 2243481
[(3R)-1-(1,3-benzodioxol-5-yl)-2,5-dioxopyrrolidin-3-yl]-(1,3-benzodioxol-5-ylmethyl)azanium (PubChem CID 2243481) has the molecular formula C19H17N2O6+ and a molecular weight of 369.35 g/mol. Its IUPAC name is [(3R)-1-(1,3-benzodioxol-5-yl)-2,5-dioxopyrrolidin-3-yl]-(1,3-benzodioxol-5-ylmethyl)azanium.
| Compound Name | [(3R)-1-(1,3-benzodioxol-5-yl)-2,5-dioxopyrrolidin-3-yl]-(1,3-benzodioxol-5-ylmethyl)azanium |
|---|---|
| PubChem CID | 2243481 |
| Molecular Formula | C19H17N2O6+ |
| Molecular Weight | 369.35 g/mol |
| Exact Mass | 369.11 |
| IUPAC Name | [(3R)-1-(1,3-benzodioxol-5-yl)-2,5-dioxopyrrolidin-3-yl]-(1,3-benzodioxol-5-ylmethyl)azanium |
| SMILES | O=C1C[C@@H]([NH2+]Cc2ccc3c(c2)OCO3)C(=O)N1c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C19H16N2O6/c22-18-7-13(20-8-11-1-3-14-16(5-11)26-9-24-14)19(23)21(18)12-2-4-15-17(6-12)27-10-25-15/h1-6,13,20H,7-10H2/p+1/t13-/m1/s1 |
| InChIKey | HLWIOUDNWQLNRK-CYBMUJFWSA-O |
| XLogP | 0.54 |
| TPSA | 90.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.35 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|