C13H18NO2+ — CID 4745321
1,3-benzodioxol-5-ylmethyl(cyclopentyl)azanium (PubChem CID 4745321) has the molecular formula C13H18NO2+ and a molecular weight of 220.29 g/mol. Its IUPAC name is 1,3-benzodioxol-5-ylmethyl(cyclopentyl)azanium.
| Compound Name | 1,3-benzodioxol-5-ylmethyl(cyclopentyl)azanium |
|---|---|
| PubChem CID | 4745321 |
| Molecular Formula | C13H18NO2+ |
| Molecular Weight | 220.29 g/mol |
| Exact Mass | 220.13 |
| IUPAC Name | 1,3-benzodioxol-5-ylmethyl(cyclopentyl)azanium |
| SMILES | c1cc2c(cc1C[NH2+]C1CCCC1)OCO2 |
| InChI | InChI=1S/C13H17NO2/c1-2-4-11(3-1)14-8-10-5-6-12-13(7-10)16-9-15-12/h5-7,11,14H,1-4,8-9H2/p+1 |
| InChIKey | LOYZMUZNAPZSOX-UHFFFAOYSA-O |
| XLogP | 1.42 |
| TPSA | 35.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.29 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |