C14H20N3O4S+ — CID 6937604
[(3S)-1-ethyl-2,5-dioxopyrrolidin-3-yl]-[2-(4-sulfamoylphenyl)ethyl]azanium (PubChem CID 6937604) has the molecular formula C14H20N3O4S+ and a molecular weight of 326.40 g/mol. Its IUPAC name is [(3S)-1-ethyl-2,5-dioxopyrrolidin-3-yl]-[2-(4-sulfamoylphenyl)ethyl]azanium.
| Compound Name | [(3S)-1-ethyl-2,5-dioxopyrrolidin-3-yl]-[2-(4-sulfamoylphenyl)ethyl]azanium |
|---|---|
| PubChem CID | 6937604 |
| Molecular Formula | C14H20N3O4S+ |
| Molecular Weight | 326.40 g/mol |
| Exact Mass | 326.12 |
| IUPAC Name | [(3S)-1-ethyl-2,5-dioxopyrrolidin-3-yl]-[2-(4-sulfamoylphenyl)ethyl]azanium |
| SMILES | CCN1C(=O)C[C@H]([NH2+]CCc2ccc(S(N)(=O)=O)cc2)C1=O |
| InChI | InChI=1S/C14H19N3O4S/c1-2-17-13(18)9-12(14(17)19)16-8-7-10-3-5-11(6-4-10)22(15,20)21/h3-6,12,16H,2,7-9H2,1H3,(H2,15,20,21)/p+1/t12-/m0/s1 |
| InChIKey | GOXSDQXIIFLUBY-LBPRGKRZSA-O |
| XLogP | -1.41 |
| TPSA | 114.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.40 |
| LogP ≤ 5 | -1.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|