C14H18N3O3+ — CID 7058200
(2-amino-2-oxoethyl)-[(3R)-2,5-dioxo-1-(2-phenylethyl)pyrrolidin-3-yl]azanium (PubChem CID 7058200) has the molecular formula C14H18N3O3+ and a molecular weight of 276.32 g/mol. Its IUPAC name is (2-amino-2-oxoethyl)-[(3R)-2,5-dioxo-1-(2-phenylethyl)pyrrolidin-3-yl]azanium.
| Compound Name | (2-amino-2-oxoethyl)-[(3R)-2,5-dioxo-1-(2-phenylethyl)pyrrolidin-3-yl]azanium |
|---|---|
| PubChem CID | 7058200 |
| Molecular Formula | C14H18N3O3+ |
| Molecular Weight | 276.32 g/mol |
| Exact Mass | 276.13 |
| IUPAC Name | (2-amino-2-oxoethyl)-[(3R)-2,5-dioxo-1-(2-phenylethyl)pyrrolidin-3-yl]azanium |
| SMILES | NC(=O)C[NH2+][C@@H]1CC(=O)N(CCc2ccccc2)C1=O |
| InChI | InChI=1S/C14H17N3O3/c15-12(18)9-16-11-8-13(19)17(14(11)20)7-6-10-4-2-1-3-5-10/h1-5,11,16H,6-9H2,(H2,15,18)/p+1/t11-/m1/s1 |
| InChIKey | ZPKKFOVMSUNTMS-LLVKDONJSA-O |
| XLogP | -1.59 |
| TPSA | 97.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.32 |
| LogP ≤ 5 | -1.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|