C19H19N3O3 — CID 3766254
N'-[2,5-dioxo-1-(2-phenylethyl)pyrrolidin-3-yl]benzohydrazide (PubChem CID 3766254) has the molecular formula C19H19N3O3 and a molecular weight of 337.38 g/mol. Its IUPAC name is N'-[2,5-dioxo-1-(2-phenylethyl)pyrrolidin-3-yl]benzohydrazide.
| Compound Name | N'-[2,5-dioxo-1-(2-phenylethyl)pyrrolidin-3-yl]benzohydrazide |
|---|---|
| PubChem CID | 3766254 |
| Molecular Formula | C19H19N3O3 |
| Molecular Weight | 337.38 g/mol |
| Exact Mass | 337.14 |
| IUPAC Name | N'-[2,5-dioxo-1-(2-phenylethyl)pyrrolidin-3-yl]benzohydrazide |
| SMILES | O=C(NNC1CC(=O)N(CCc2ccccc2)C1=O)c1ccccc1 |
| InChI | InChI=1S/C19H19N3O3/c23-17-13-16(20-21-18(24)15-9-5-2-6-10-15)19(25)22(17)12-11-14-7-3-1-4-8-14/h1-10,16,20H,11-13H2,(H,21,24) |
| InChIKey | CCRLITLTEFNCIU-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.38 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|