About N'-[2,5-dioxo-1-(2-phenylethyl)pyrrolidin-3-yl]benzohydrazide
N'-[2,5-dioxo-1-(2-phenylethyl)pyrrolidin-3-yl]benzohydrazide (PubChem CID 3766254) has the molecular formula C19H19N3O3
and a molecular weight of 337.38 g/mol. Its IUPAC name is N'-[2,5-dioxo-1-(2-phenylethyl)pyrrolidin-3-yl]benzohydrazide.
Molecular Properties
| Compound Name | N'-[2,5-dioxo-1-(2-phenylethyl)pyrrolidin-3-yl]benzohydrazide |
| PubChem CID | 3766254 |
| Molecular Formula | C19H19N3O3 |
| Molecular Weight | 337.38 g/mol |
| Exact Mass | 337.14 |
| IUPAC Name | N'-[2,5-dioxo-1-(2-phenylethyl)pyrrolidin-3-yl]benzohydrazide |
| SMILES | O=C(NNC1CC(=O)N(CCc2ccccc2)C1=O)c1ccccc1 |
| InChI | InChI=1S/C19H19N3O3/c23-17-13-16(20-21-18(24)15-9-5-2-6-10-15)19(25)22(17)12-11-14-7-3-1-4-8-14/h1-10,16,20H,11-13H2,(H,21,24) |
| InChIKey | CCRLITLTEFNCIU-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 337.38 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze N'-[2,5-dioxo-1-(2-phenylethyl)pyrrolidin-3-yl]benzohydrazide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-[2,5-dioxo-1-(2-phenylethyl)pyrrolidin-3-yl]benzohydrazide?
The IUPAC name of N'-[2,5-dioxo-1-(2-phenylethyl)pyrrolidin-3-yl]benzohydrazide (CID 3766254) is N'-[2,5-dioxo-1-(2-phenylethyl)pyrrolidin-3-yl]benzohydrazide.
What is the SMILES notation for N'-[2,5-dioxo-1-(2-phenylethyl)pyrrolidin-3-yl]benzohydrazide?
The canonical SMILES for N'-[2,5-dioxo-1-(2-phenylethyl)pyrrolidin-3-yl]benzohydrazide is O=C(NNC1CC(=O)N(CCc2ccccc2)C1=O)c1ccccc1.
What is the InChIKey of N'-[2,5-dioxo-1-(2-phenylethyl)pyrrolidin-3-yl]benzohydrazide?
The InChIKey is CCRLITLTEFNCIU-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H19N3O3/c23-17-13-16(20-21-18(24)15-9-5-2-6-10-15)19(25)22(17)12-11-14-7-3-1-4-8-14/h1-10,16,20H,11-13H2,(H,21,24).
What are the key properties of N'-[2,5-dioxo-1-(2-phenylethyl)pyrrolidin-3-yl]benzohydrazide?
N'-[2,5-dioxo-1-(2-phenylethyl)pyrrolidin-3-yl]benzohydrazide has a molecular weight of 337.38 g/mol, XLogP of 1.29, 6 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N'-[2,5-dioxo-1-(2-phenylethyl)pyrrolidin-3-yl]benzohydrazide is sourced from PubChem (CID 3766254), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).