C19H18N6O2 — CID 42911442
1-(2-phenylethyl)-3-[4-(tetrazol-1-yl)anilino]pyrrolidine-2,5-dione (PubChem CID 42911442) has the molecular formula C19H18N6O2 and a molecular weight of 362.39 g/mol. Its IUPAC name is 1-(2-phenylethyl)-3-[4-(tetrazol-1-yl)anilino]pyrrolidine-2,5-dione.
| Compound Name | 1-(2-phenylethyl)-3-[4-(tetrazol-1-yl)anilino]pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 42911442 |
| Molecular Formula | C19H18N6O2 |
| Molecular Weight | 362.39 g/mol |
| Exact Mass | 362.15 |
| IUPAC Name | 1-(2-phenylethyl)-3-[4-(tetrazol-1-yl)anilino]pyrrolidine-2,5-dione |
| SMILES | O=C1CC(Nc2ccc(-n3cnnn3)cc2)C(=O)N1CCc1ccccc1 |
| InChI | InChI=1S/C19H18N6O2/c26-18-12-17(19(27)24(18)11-10-14-4-2-1-3-5-14)21-15-6-8-16(9-7-15)25-13-20-22-23-25/h1-9,13,17,21H,10-12H2 |
| InChIKey | YTAGXAOAIIPMTO-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 93.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.39 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|