C17H24N2O2 — CID 43636391
3-(4-tert-butylanilino)-1-propylpyrrolidine-2,5-dione (PubChem CID 43636391) has the molecular formula C17H24N2O2 and a molecular weight of 288.39 g/mol. Its IUPAC name is 3-(4-tert-butylanilino)-1-propylpyrrolidine-2,5-dione.
| Compound Name | 3-(4-tert-butylanilino)-1-propylpyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 43636391 |
| Molecular Formula | C17H24N2O2 |
| Molecular Weight | 288.39 g/mol |
| Exact Mass | 288.18 |
| IUPAC Name | 3-(4-tert-butylanilino)-1-propylpyrrolidine-2,5-dione |
| SMILES | CCCN1C(=O)CC(Nc2ccc(C(C)(C)C)cc2)C1=O |
| InChI | InChI=1S/C17H24N2O2/c1-5-10-19-15(20)11-14(16(19)21)18-13-8-6-12(7-9-13)17(2,3)4/h6-9,14,18H,5,10-11H2,1-4H3 |
| InChIKey | GTXCHVPJWAJDIJ-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.39 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|