C16H21N3O2 — CID 63179546
1-ethyl-3-(4-pyrrolidin-1-ylanilino)pyrrolidine-2,5-dione (PubChem CID 63179546) has the molecular formula C16H21N3O2 and a molecular weight of 287.36 g/mol. Its IUPAC name is 1-ethyl-3-(4-pyrrolidin-1-ylanilino)pyrrolidine-2,5-dione.
| Compound Name | 1-ethyl-3-(4-pyrrolidin-1-ylanilino)pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 63179546 |
| Molecular Formula | C16H21N3O2 |
| Molecular Weight | 287.36 g/mol |
| Exact Mass | 287.16 |
| IUPAC Name | 1-ethyl-3-(4-pyrrolidin-1-ylanilino)pyrrolidine-2,5-dione |
| SMILES | CCN1C(=O)CC(Nc2ccc(N3CCCC3)cc2)C1=O |
| InChI | InChI=1S/C16H21N3O2/c1-2-19-15(20)11-14(16(19)21)17-12-5-7-13(8-6-12)18-9-3-4-10-18/h5-8,14,17H,2-4,9-11H2,1H3 |
| InChIKey | JUZFMWLYXOIAGR-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.36 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|