C14H12N4O2 — CID 107788732
4-[(1-ethyl-2,5-dioxopyrrolidin-3-yl)amino]benzene-1,2-dicarbonitrile (PubChem CID 107788732) has the molecular formula C14H12N4O2 and a molecular weight of 268.28 g/mol. Its IUPAC name is 4-[(1-ethyl-2,5-dioxopyrrolidin-3-yl)amino]benzene-1,2-dicarbonitrile.
| Compound Name | 4-[(1-ethyl-2,5-dioxopyrrolidin-3-yl)amino]benzene-1,2-dicarbonitrile |
|---|---|
| PubChem CID | 107788732 |
| Molecular Formula | C14H12N4O2 |
| Molecular Weight | 268.28 g/mol |
| Exact Mass | 268.10 |
| IUPAC Name | 4-[(1-ethyl-2,5-dioxopyrrolidin-3-yl)amino]benzene-1,2-dicarbonitrile |
| SMILES | CCN1C(=O)CC(Nc2ccc(C#N)c(C#N)c2)C1=O |
| InChI | InChI=1S/C14H12N4O2/c1-2-18-13(19)6-12(14(18)20)17-11-4-3-9(7-15)10(5-11)8-16/h3-5,12,17H,2,6H2,1H3 |
| InChIKey | GWBDNQAXEWAJGH-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 96.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.28 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|