C16H23N3O2 — CID 92537847
(3S)-1-butyl-3-[4-(dimethylamino)anilino]pyrrolidine-2,5-dione (PubChem CID 92537847) has the molecular formula C16H23N3O2 and a molecular weight of 289.38 g/mol. Its IUPAC name is (3S)-1-butyl-3-[4-(dimethylamino)anilino]pyrrolidine-2,5-dione.
| Compound Name | (3S)-1-butyl-3-[4-(dimethylamino)anilino]pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 92537847 |
| Molecular Formula | C16H23N3O2 |
| Molecular Weight | 289.38 g/mol |
| Exact Mass | 289.18 |
| IUPAC Name | (3S)-1-butyl-3-[4-(dimethylamino)anilino]pyrrolidine-2,5-dione |
| SMILES | CCCCN1C(=O)C[C@H](Nc2ccc(N(C)C)cc2)C1=O |
| InChI | InChI=1S/C16H23N3O2/c1-4-5-10-19-15(20)11-14(16(19)21)17-12-6-8-13(9-7-12)18(2)3/h6-9,14,17H,4-5,10-11H2,1-3H3/t14-/m0/s1 |
| InChIKey | RMOAOQLOOYIDOP-AWEZNQCLSA-N |
| XLogP | 2.09 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.38 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|