C19H18N6O4 — CID 51660732
(3S)-1-(2,4-dimethoxyphenyl)-3-[4-(tetrazol-1-yl)anilino]pyrrolidine-2,5-dione (PubChem CID 51660732) has the molecular formula C19H18N6O4 and a molecular weight of 394.39 g/mol. Its IUPAC name is (3S)-1-(2,4-dimethoxyphenyl)-3-[4-(tetrazol-1-yl)anilino]pyrrolidine-2,5-dione.
| Compound Name | (3S)-1-(2,4-dimethoxyphenyl)-3-[4-(tetrazol-1-yl)anilino]pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 51660732 |
| Molecular Formula | C19H18N6O4 |
| Molecular Weight | 394.39 g/mol |
| Exact Mass | 394.14 |
| IUPAC Name | (3S)-1-(2,4-dimethoxyphenyl)-3-[4-(tetrazol-1-yl)anilino]pyrrolidine-2,5-dione |
| SMILES | COc1ccc(N2C(=O)C[C@H](Nc3ccc(-n4cnnn4)cc3)C2=O)c(OC)c1 |
| InChI | InChI=1S/C19H18N6O4/c1-28-14-7-8-16(17(9-14)29-2)25-18(26)10-15(19(25)27)21-12-3-5-13(6-4-12)24-11-20-22-23-24/h3-9,11,15,21H,10H2,1-2H3/t15-/m0/s1 |
| InChIKey | VETKDJVPBVXKTF-HNNXBMFYSA-N |
| XLogP | 1.42 |
| TPSA | 111.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.39 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|