C18H16Cl2N2O4 — CID 93235231
(3R)-3-(2,3-dichloroanilino)-1-(2,4-dimethoxyphenyl)pyrrolidine-2,5-dione (PubChem CID 93235231) has the molecular formula C18H16Cl2N2O4 and a molecular weight of 395.24 g/mol. Its IUPAC name is (3R)-3-(2,3-dichloroanilino)-1-(2,4-dimethoxyphenyl)pyrrolidine-2,5-dione.
| Compound Name | (3R)-3-(2,3-dichloroanilino)-1-(2,4-dimethoxyphenyl)pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 93235231 |
| Molecular Formula | C18H16Cl2N2O4 |
| Molecular Weight | 395.24 g/mol |
| Exact Mass | 394.05 |
| IUPAC Name | (3R)-3-(2,3-dichloroanilino)-1-(2,4-dimethoxyphenyl)pyrrolidine-2,5-dione |
| SMILES | COc1ccc(N2C(=O)C[C@@H](Nc3cccc(Cl)c3Cl)C2=O)c(OC)c1 |
| InChI | InChI=1S/C18H16Cl2N2O4/c1-25-10-6-7-14(15(8-10)26-2)22-16(23)9-13(18(22)24)21-12-5-3-4-11(19)17(12)20/h3-8,13,21H,9H2,1-2H3/t13-/m1/s1 |
| InChIKey | LWMKSPCCEMSIOX-CYBMUJFWSA-N |
| XLogP | 3.75 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.24 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|