C20H22N2O4 — CID 98188014
(3R)-3-(2,4-dimethoxyanilino)-1-(2,6-dimethylphenyl)pyrrolidine-2,5-dione (PubChem CID 98188014) has the molecular formula C20H22N2O4 and a molecular weight of 354.41 g/mol. Its IUPAC name is (3R)-3-(2,4-dimethoxyanilino)-1-(2,6-dimethylphenyl)pyrrolidine-2,5-dione.
| Compound Name | (3R)-3-(2,4-dimethoxyanilino)-1-(2,6-dimethylphenyl)pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 98188014 |
| Molecular Formula | C20H22N2O4 |
| Molecular Weight | 354.41 g/mol |
| Exact Mass | 354.16 |
| IUPAC Name | (3R)-3-(2,4-dimethoxyanilino)-1-(2,6-dimethylphenyl)pyrrolidine-2,5-dione |
| SMILES | COc1ccc(N[C@@H]2CC(=O)N(c3c(C)cccc3C)C2=O)c(OC)c1 |
| InChI | InChI=1S/C20H22N2O4/c1-12-6-5-7-13(2)19(12)22-18(23)11-16(20(22)24)21-15-9-8-14(25-3)10-17(15)26-4/h5-10,16,21H,11H2,1-4H3/t16-/m1/s1 |
| InChIKey | RDZVZYPABZXAKT-MRXNPFEDSA-N |
| XLogP | 3.06 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.41 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|