C20H22N2O3 — CID 98188035
(3R)-3-(2-methoxyanilino)-1-(2,4,6-trimethylphenyl)pyrrolidine-2,5-dione (PubChem CID 98188035) has the molecular formula C20H22N2O3 and a molecular weight of 338.41 g/mol. Its IUPAC name is (3R)-3-(2-methoxyanilino)-1-(2,4,6-trimethylphenyl)pyrrolidine-2,5-dione.
| Compound Name | (3R)-3-(2-methoxyanilino)-1-(2,4,6-trimethylphenyl)pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 98188035 |
| Molecular Formula | C20H22N2O3 |
| Molecular Weight | 338.41 g/mol |
| Exact Mass | 338.16 |
| IUPAC Name | (3R)-3-(2-methoxyanilino)-1-(2,4,6-trimethylphenyl)pyrrolidine-2,5-dione |
| SMILES | COc1ccccc1N[C@@H]1CC(=O)N(c2c(C)cc(C)cc2C)C1=O |
| InChI | InChI=1S/C20H22N2O3/c1-12-9-13(2)19(14(3)10-12)22-18(23)11-16(20(22)24)21-15-7-5-6-8-17(15)25-4/h5-10,16,21H,11H2,1-4H3/t16-/m1/s1 |
| InChIKey | DXNIGCBLMXFTHP-MRXNPFEDSA-N |
| XLogP | 3.36 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.41 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|