C21H24N2O2 — CID 51860012
(3R)-3-(2-ethylanilino)-1-(2,4,6-trimethylphenyl)pyrrolidine-2,5-dione (PubChem CID 51860012) has the molecular formula C21H24N2O2 and a molecular weight of 336.44 g/mol. Its IUPAC name is (3R)-3-(2-ethylanilino)-1-(2,4,6-trimethylphenyl)pyrrolidine-2,5-dione.
| Compound Name | (3R)-3-(2-ethylanilino)-1-(2,4,6-trimethylphenyl)pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 51860012 |
| Molecular Formula | C21H24N2O2 |
| Molecular Weight | 336.44 g/mol |
| Exact Mass | 336.18 |
| IUPAC Name | (3R)-3-(2-ethylanilino)-1-(2,4,6-trimethylphenyl)pyrrolidine-2,5-dione |
| SMILES | CCc1ccccc1N[C@@H]1CC(=O)N(c2c(C)cc(C)cc2C)C1=O |
| InChI | InChI=1S/C21H24N2O2/c1-5-16-8-6-7-9-17(16)22-18-12-19(24)23(21(18)25)20-14(3)10-13(2)11-15(20)4/h6-11,18,22H,5,12H2,1-4H3/t18-/m1/s1 |
| InChIKey | RYVARZGAXWEFLK-GOSISDBHSA-N |
| XLogP | 3.92 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.44 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|