C19H20N2O2 — CID 138958689
1-(3,5-dimethylphenyl)-3-(2-methylanilino)pyrrolidine-2,5-dione (PubChem CID 138958689) has the molecular formula C19H20N2O2 and a molecular weight of 308.38 g/mol. Its IUPAC name is 1-(3,5-dimethylphenyl)-3-(2-methylanilino)pyrrolidine-2,5-dione.
| Compound Name | 1-(3,5-dimethylphenyl)-3-(2-methylanilino)pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 138958689 |
| Molecular Formula | C19H20N2O2 |
| Molecular Weight | 308.38 g/mol |
| Exact Mass | 308.15 |
| IUPAC Name | 1-(3,5-dimethylphenyl)-3-(2-methylanilino)pyrrolidine-2,5-dione |
| SMILES | Cc1cc(C)cc(N2C(=O)CC(Nc3ccccc3C)C2=O)c1 |
| InChI | InChI=1S/C19H20N2O2/c1-12-8-13(2)10-15(9-12)21-18(22)11-17(19(21)23)20-16-7-5-4-6-14(16)3/h4-10,17,20H,11H2,1-3H3 |
| InChIKey | YHJCYUJJFLFLCN-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.38 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|